About N'-phenyl-N'-propylacetohydrazide
N'-phenyl-N'-propylacetohydrazide (PubChem CID 100919129) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is N'-phenyl-N'-propylacetohydrazide.
Molecular Properties
| Compound Name | N'-phenyl-N'-propylacetohydrazide |
| PubChem CID | 100919129 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N'-phenyl-N'-propylacetohydrazide |
| SMILES | CCCN(NC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C11H16N2O/c1-3-9-13(12-10(2)14)11-7-5-4-6-8-11/h4-8H,3,9H2,1-2H3,(H,12,14) |
| InChIKey | MFNCHNBUEWPMSH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-phenyl-N'-propylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-phenyl-N'-propylacetohydrazide?
The IUPAC name of N'-phenyl-N'-propylacetohydrazide (CID 100919129) is N'-phenyl-N'-propylacetohydrazide.
What is the SMILES notation for N'-phenyl-N'-propylacetohydrazide?
The canonical SMILES for N'-phenyl-N'-propylacetohydrazide is CCCN(NC(C)=O)c1ccccc1.
What is the InChIKey of N'-phenyl-N'-propylacetohydrazide?
The InChIKey is MFNCHNBUEWPMSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c1-3-9-13(12-10(2)14)11-7-5-4-6-8-11/h4-8H,3,9H2,1-2H3,(H,12,14).
What are the key properties of N'-phenyl-N'-propylacetohydrazide?
N'-phenyl-N'-propylacetohydrazide has a molecular weight of 192.26 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-phenyl-N'-propylacetohydrazide is sourced from PubChem (CID 100919129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).