About N'-acetyl-N'-benzylacetohydrazide
N'-acetyl-N'-benzylacetohydrazide (PubChem CID 23198251) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is N'-acetyl-N'-benzylacetohydrazide.
Molecular Properties
| Compound Name | N'-acetyl-N'-benzylacetohydrazide |
| PubChem CID | 23198251 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N'-acetyl-N'-benzylacetohydrazide |
| SMILES | CC(=O)NN(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C11H14N2O2/c1-9(14)12-13(10(2)15)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,12,14) |
| InChIKey | MKEUACOWXGOKIS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-acetyl-N'-benzylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetyl-N'-benzylacetohydrazide?
The IUPAC name of N'-acetyl-N'-benzylacetohydrazide (CID 23198251) is N'-acetyl-N'-benzylacetohydrazide.
What is the SMILES notation for N'-acetyl-N'-benzylacetohydrazide?
The canonical SMILES for N'-acetyl-N'-benzylacetohydrazide is CC(=O)NN(Cc1ccccc1)C(C)=O.
What is the InChIKey of N'-acetyl-N'-benzylacetohydrazide?
The InChIKey is MKEUACOWXGOKIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-9(14)12-13(10(2)15)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,12,14).
What are the key properties of N'-acetyl-N'-benzylacetohydrazide?
N'-acetyl-N'-benzylacetohydrazide has a molecular weight of 206.25 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetyl-N'-benzylacetohydrazide is sourced from PubChem (CID 23198251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).