C12H15Cl3N2O — CID 2843650
N-[1-[benzyl(methyl)amino]-2,2,2-trichloroethyl]acetamide (PubChem CID 2843650) has the molecular formula C12H15Cl3N2O and a molecular weight of 309.62 g/mol. Its IUPAC name is N-[1-[benzyl(methyl)amino]-2,2,2-trichloroethyl]acetamide.
| Compound Name | N-[1-[benzyl(methyl)amino]-2,2,2-trichloroethyl]acetamide |
|---|---|
| PubChem CID | 2843650 |
| Molecular Formula | C12H15Cl3N2O |
| Molecular Weight | 309.62 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | N-[1-[benzyl(methyl)amino]-2,2,2-trichloroethyl]acetamide |
| SMILES | CC(=O)NC(N(C)Cc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H15Cl3N2O/c1-9(18)16-11(12(13,14)15)17(2)8-10-6-4-3-5-7-10/h3-7,11H,8H2,1-2H3,(H,16,18) |
| InChIKey | UAYQNAITJUZJCZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|