C19H20F3NO — CID 10497008
(4R)-4-[benzyl(methyl)amino]-5,5,5-trifluoro-1-phenylpentan-1-one (PubChem CID 10497008) has the molecular formula C19H20F3NO and a molecular weight of 335.37 g/mol. Its IUPAC name is (4R)-4-[benzyl(methyl)amino]-5,5,5-trifluoro-1-phenylpentan-1-one.
| Compound Name | (4R)-4-[benzyl(methyl)amino]-5,5,5-trifluoro-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 10497008 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (4R)-4-[benzyl(methyl)amino]-5,5,5-trifluoro-1-phenylpentan-1-one |
| SMILES | CN(Cc1ccccc1)[C@H](CCC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H20F3NO/c1-23(14-15-8-4-2-5-9-15)18(19(20,21)22)13-12-17(24)16-10-6-3-7-11-16/h2-11,18H,12-14H2,1H3/t18-/m1/s1 |
| InChIKey | KJAZQGSJWDGRQT-GOSISDBHSA-N |
| XLogP | 4.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |