C12H13F3O2 — CID 116692171
1-phenyl-3-(1,1,1-trifluoropropan-2-yloxy)propan-1-one (PubChem CID 116692171) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 1-phenyl-3-(1,1,1-trifluoropropan-2-yloxy)propan-1-one.
| Compound Name | 1-phenyl-3-(1,1,1-trifluoropropan-2-yloxy)propan-1-one |
|---|---|
| PubChem CID | 116692171 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-phenyl-3-(1,1,1-trifluoropropan-2-yloxy)propan-1-one |
| SMILES | CC(OCCC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O2/c1-9(12(13,14)15)17-8-7-11(16)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3 |
| InChIKey | YHBGJHKGEDJCBC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |