About (3-oxo-3-phenylpropyl) hydrogen sulfite
(3-oxo-3-phenylpropyl) hydrogen sulfite (PubChem CID 174749315) has the molecular formula C9H10O4S
and a molecular weight of 214.24 g/mol. Its IUPAC name is (3-oxo-3-phenylpropyl) hydrogen sulfite.
Molecular Properties
| Compound Name | (3-oxo-3-phenylpropyl) hydrogen sulfite |
| PubChem CID | 174749315 |
| Molecular Formula | C9H10O4S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | (3-oxo-3-phenylpropyl) hydrogen sulfite |
| SMILES | O=C(CCOS(=O)O)c1ccccc1 |
| InChI | InChI=1S/C9H10O4S/c10-9(6-7-13-14(11)12)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12) |
| InChIKey | ZTMOGVNQMXKYON-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (3-oxo-3-phenylpropyl) hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-3-phenylpropyl) hydrogen sulfite?
The IUPAC name of (3-oxo-3-phenylpropyl) hydrogen sulfite (CID 174749315) is (3-oxo-3-phenylpropyl) hydrogen sulfite.
What is the SMILES notation for (3-oxo-3-phenylpropyl) hydrogen sulfite?
The canonical SMILES for (3-oxo-3-phenylpropyl) hydrogen sulfite is O=C(CCOS(=O)O)c1ccccc1.
What is the InChIKey of (3-oxo-3-phenylpropyl) hydrogen sulfite?
The InChIKey is ZTMOGVNQMXKYON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4S/c10-9(6-7-13-14(11)12)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12).
What are the key properties of (3-oxo-3-phenylpropyl) hydrogen sulfite?
(3-oxo-3-phenylpropyl) hydrogen sulfite has a molecular weight of 214.24 g/mol, XLogP of 1.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-3-phenylpropyl) hydrogen sulfite is sourced from PubChem (CID 174749315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).