About (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate
(4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate (PubChem CID 176803320) has the molecular formula C10H14NO4Y2-
and a molecular weight of 390.04 g/mol. Its IUPAC name is (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate.
Molecular Properties
| Compound Name | (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate |
| PubChem CID | 176803320 |
| Molecular Formula | C10H14NO4Y2- |
| Molecular Weight | 390.04 g/mol |
| Exact Mass | 389.90 |
| IUPAC Name | (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate |
| SMILES | O.O.[NH-]C(=O)CCC(=O)c1ccccc1.[Y].[Y] |
| InChI | InChI=1S/C10H11NO2.2H2O.2Y/c11-10(13)7-6-9(12)8-4-2-1-3-5-8;;;;/h1-5H,6-7H2,(H2,11,13);2*1H2;;/p-1 |
| InChIKey | YPIRVWHBAJJOTN-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.04 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate?
The IUPAC name of (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate (CID 176803320) is (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate.
What is the SMILES notation for (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate?
The canonical SMILES for (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate is O.O.[NH-]C(=O)CCC(=O)c1ccccc1.[Y].[Y].
What is the InChIKey of (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate?
The InChIKey is YPIRVWHBAJJOTN-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H11NO2.2H2O.2Y/c11-10(13)7-6-9(12)8-4-2-1-3-5-8;;;;/h1-5H,6-7H2,(H2,11,13);2*1H2;;/p-1.
What are the key properties of (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate?
(4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate has a molecular weight of 390.04 g/mol, XLogP of 0.57, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-4-phenylbutanoyl)azanide;bis(yttrium);dihydrate is sourced from PubChem (CID 176803320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).