C24H31OSi — CID 16688129
CID 16688129 (PubChem CID 16688129) has the molecular formula C24H31OSi and a molecular weight of 363.60 g/mol.
| Compound Name | CID 16688129 |
|---|---|
| PubChem CID | 16688129 |
| Molecular Formula | C24H31OSi |
| Molecular Weight | 363.60 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[CH][C](/[C]=C/C(C)(C)C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31OSi/c1-23(2,3)18-17-22(19-24(4,5)6)26(25,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,18-19,25H,1-6H3 |
| InChIKey | UJPREYWQBIHZNP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|