C16H23N — CID 114099863
2,2,3-trimethyl-N-(3-phenylprop-2-ynyl)butan-1-amine (PubChem CID 114099863) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 2,2,3-trimethyl-N-(3-phenylprop-2-ynyl)butan-1-amine.
| Compound Name | 2,2,3-trimethyl-N-(3-phenylprop-2-ynyl)butan-1-amine |
|---|---|
| PubChem CID | 114099863 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2,2,3-trimethyl-N-(3-phenylprop-2-ynyl)butan-1-amine |
| SMILES | CC(C)C(C)(C)CNCC#Cc1ccccc1 |
| InChI | InChI=1S/C16H23N/c1-14(2)16(3,4)13-17-12-8-11-15-9-6-5-7-10-15/h5-7,9-10,14,17H,12-13H2,1-4H3 |
| InChIKey | PMBQKSBLOXACJG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|