C15H22N2 — CID 102609962
2-[(2,2,3-trimethylbutylamino)methyl]benzonitrile (PubChem CID 102609962) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[(2,2,3-trimethylbutylamino)methyl]benzonitrile.
| Compound Name | 2-[(2,2,3-trimethylbutylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 102609962 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-[(2,2,3-trimethylbutylamino)methyl]benzonitrile |
| SMILES | CC(C)C(C)(C)CNCc1ccccc1C#N |
| InChI | InChI=1S/C15H22N2/c1-12(2)15(3,4)11-17-10-14-8-6-5-7-13(14)9-16/h5-8,12,17H,10-11H2,1-4H3 |
| InChIKey | BSRIQZQZFSOQOA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |