C18H27N3O2 — CID 103851687
tert-butyl N-[3-[(2-cyanophenyl)methylamino]-2-methylpropyl]-N-methylcarbamate (PubChem CID 103851687) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-cyanophenyl)methylamino]-2-methylpropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[(2-cyanophenyl)methylamino]-2-methylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 103851687 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | tert-butyl N-[3-[(2-cyanophenyl)methylamino]-2-methylpropyl]-N-methylcarbamate |
| SMILES | CC(CNCc1ccccc1C#N)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27N3O2/c1-14(13-21(5)17(22)23-18(2,3)4)11-20-12-16-9-7-6-8-15(16)10-19/h6-9,14,20H,11-13H2,1-5H3 |
| InChIKey | OXBAJAFJCRBOQP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |