C15H22ClN7O2 — CID 151377326
tert-butyl N-[9-chloro-8-(4-methylpiperazin-1-yl)purin-2-yl]carbamate (PubChem CID 151377326) has the molecular formula C15H22ClN7O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is tert-butyl N-[9-chloro-8-(4-methylpiperazin-1-yl)purin-2-yl]carbamate.
| Compound Name | tert-butyl N-[9-chloro-8-(4-methylpiperazin-1-yl)purin-2-yl]carbamate |
|---|---|
| PubChem CID | 151377326 |
| Molecular Formula | C15H22ClN7O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | tert-butyl N-[9-chloro-8-(4-methylpiperazin-1-yl)purin-2-yl]carbamate |
| SMILES | CN1CCN(c2nc3cnc(NC(=O)OC(C)(C)C)nc3n2Cl)CC1 |
| InChI | InChI=1S/C15H22ClN7O2/c1-15(2,3)25-14(24)20-12-17-9-10-11(19-12)23(16)13(18-10)22-7-5-21(4)6-8-22/h9H,5-8H2,1-4H3,(H,17,19,20,24) |
| InChIKey | ORRFYXXXDCYZSU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |