C28H41N7O3 — CID 66869312
tert-butyl 4-amino-2,3-bis[5-(4-methylpiperazin-1-yl)-3-pyridinyl]-4-oxobutanoate (PubChem CID 66869312) has the molecular formula C28H41N7O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is tert-butyl 4-amino-2,3-bis[5-(4-methylpiperazin-1-yl)-3-pyridinyl]-4-oxobutanoate.
| Compound Name | tert-butyl 4-amino-2,3-bis[5-(4-methylpiperazin-1-yl)-3-pyridinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 66869312 |
| Molecular Formula | C28H41N7O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | tert-butyl 4-amino-2,3-bis[5-(4-methylpiperazin-1-yl)-3-pyridinyl]-4-oxobutanoate |
| SMILES | CN1CCN(c2cncc(C(C(N)=O)C(C(=O)OC(C)(C)C)c3cncc(N4CCN(C)CC4)c3)c2)CC1 |
| InChI | InChI=1S/C28H41N7O3/c1-28(2,3)38-27(37)25(21-15-23(19-31-17-21)35-12-8-33(5)9-13-35)24(26(29)36)20-14-22(18-30-16-20)34-10-6-32(4)7-11-34/h14-19,24-25H,6-13H2,1-5H3,(H2,29,36) |
| InChIKey | QHURMZFRZBPOMX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |