C17H23N3O2 — CID 22478542
tert-butyl 4-(5-ethynyl-3-pyridinyl)-1,4-diazepane-1-carboxylate (PubChem CID 22478542) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl 4-(5-ethynyl-3-pyridinyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(5-ethynyl-3-pyridinyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 22478542 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | tert-butyl 4-(5-ethynyl-3-pyridinyl)-1,4-diazepane-1-carboxylate |
| SMILES | C#Cc1cncc(N2CCCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C17H23N3O2/c1-5-14-11-15(13-18-12-14)19-7-6-8-20(10-9-19)16(21)22-17(2,3)4/h1,11-13H,6-10H2,2-4H3 |
| InChIKey | JHPHAAHYJBMFFS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|