C14H11Cl2F3N4 — CID 169228117
2,7-dichloro-4-[(1R,5S)-8,8-difluoro-3-azabicyclo[3.2.1]octan-3-yl]-8-fluoropyrido[4,3-d]pyrimidine (PubChem CID 169228117) has the molecular formula C14H11Cl2F3N4 and a molecular weight of 363.17 g/mol. Its IUPAC name is 2,7-dichloro-4-[(1R,5S)-8,8-difluoro-3-azabicyclo[3.2.1]octan-3-yl]-8-fluoropyrido[4,3-d]pyrimidine.
| Compound Name | 2,7-dichloro-4-[(1R,5S)-8,8-difluoro-3-azabicyclo[3.2.1]octan-3-yl]-8-fluoropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 169228117 |
| Molecular Formula | C14H11Cl2F3N4 |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 2,7-dichloro-4-[(1R,5S)-8,8-difluoro-3-azabicyclo[3.2.1]octan-3-yl]-8-fluoropyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(Cl)ncc2c(N3C[C@H]4CC[C@@H](C3)C4(F)F)nc(Cl)nc12 |
| InChI | InChI=1S/C14H11Cl2F3N4/c15-11-9(17)10-8(3-20-11)12(22-13(16)21-10)23-4-6-1-2-7(5-23)14(6,18)19/h3,6-7H,1-2,4-5H2/t6-,7+ |
| InChIKey | IYBOJZDVNMTNED-KNVOCYPGSA-N |
| XLogP | 3.95 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|