C13H11Cl2FN6 — CID 164922384
2-[(2S)-4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperazin-2-yl]acetonitrile (PubChem CID 164922384) has the molecular formula C13H11Cl2FN6 and a molecular weight of 341.18 g/mol. Its IUPAC name is 2-[(2S)-4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 164922384 |
| Molecular Formula | C13H11Cl2FN6 |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-[(2S)-4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperazin-2-yl]acetonitrile |
| SMILES | N#CC[C@H]1CN(c2nc(Cl)nc3c(F)c(Cl)ncc23)CCN1 |
| InChI | InChI=1S/C13H11Cl2FN6/c14-11-9(16)10-8(5-19-11)12(21-13(15)20-10)22-4-3-18-7(6-22)1-2-17/h5,7,18H,1,3-4,6H2/t7-/m0/s1 |
| InChIKey | MFDKSTPYVXNYCS-ZETCQYMHSA-N |
| XLogP | 2.16 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|