C15H15Cl2FN4 — CID 170957455
2,7-dichloro-8-fluoro-4-(3-prop-2-enylpiperidin-1-yl)pyrido[4,3-d]pyrimidine (PubChem CID 170957455) has the molecular formula C15H15Cl2FN4 and a molecular weight of 341.22 g/mol. Its IUPAC name is 2,7-dichloro-8-fluoro-4-(3-prop-2-enylpiperidin-1-yl)pyrido[4,3-d]pyrimidine.
| Compound Name | 2,7-dichloro-8-fluoro-4-(3-prop-2-enylpiperidin-1-yl)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 170957455 |
| Molecular Formula | C15H15Cl2FN4 |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2,7-dichloro-8-fluoro-4-(3-prop-2-enylpiperidin-1-yl)pyrido[4,3-d]pyrimidine |
| SMILES | C=CCC1CCCN(c2nc(Cl)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C15H15Cl2FN4/c1-2-4-9-5-3-6-22(8-9)14-10-7-19-13(16)11(18)12(10)20-15(17)21-14/h2,7,9H,1,3-6,8H2 |
| InChIKey | YICPUJDMWUWMGZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|