C13H14ClFN4O2 — CID 164535261
1-(7-chloro-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl)piperidin-3-ol (PubChem CID 164535261) has the molecular formula C13H14ClFN4O2 and a molecular weight of 312.73 g/mol. Its IUPAC name is 1-(7-chloro-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl)piperidin-3-ol.
| Compound Name | 1-(7-chloro-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 164535261 |
| Molecular Formula | C13H14ClFN4O2 |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(7-chloro-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl)piperidin-3-ol |
| SMILES | COc1nc(N2CCCC(O)C2)c2cnc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C13H14ClFN4O2/c1-21-13-17-10-8(5-16-11(14)9(10)15)12(18-13)19-4-2-3-7(20)6-19/h5,7,20H,2-4,6H2,1H3 |
| InChIKey | QOVVPDLGAPQAJW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|