C18H21Cl2FN4O — CID 170320347
2-tert-butyl-8-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1-oxa-8-azaspiro[3.5]nonane (PubChem CID 170320347) has the molecular formula C18H21Cl2FN4O and a molecular weight of 399.30 g/mol. Its IUPAC name is 2-tert-butyl-8-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1-oxa-8-azaspiro[3.5]nonane.
| Compound Name | 2-tert-butyl-8-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1-oxa-8-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 170320347 |
| Molecular Formula | C18H21Cl2FN4O |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-tert-butyl-8-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1-oxa-8-azaspiro[3.5]nonane |
| SMILES | CC(C)(C)C1CC2(CCCN(c3nc(Cl)nc4c(F)c(Cl)ncc34)C2)O1 |
| InChI | InChI=1S/C18H21Cl2FN4O/c1-17(2,3)11-7-18(26-11)5-4-6-25(9-18)15-10-8-22-14(19)12(21)13(10)23-16(20)24-15/h8,11H,4-7,9H2,1-3H3 |
| InChIKey | RCSUGWMNQXAUMB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|