C17H18Cl2F3N5O2 — CID 170309185
[2-tert-butyl-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-5,5-difluoropiperidin-3-yl] carbamate (PubChem CID 170309185) has the molecular formula C17H18Cl2F3N5O2 and a molecular weight of 452.26 g/mol. Its IUPAC name is [2-tert-butyl-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-5,5-difluoropiperidin-3-yl] carbamate.
| Compound Name | [2-tert-butyl-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-5,5-difluoropiperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 170309185 |
| Molecular Formula | C17H18Cl2F3N5O2 |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | [2-tert-butyl-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-5,5-difluoropiperidin-3-yl] carbamate |
| SMILES | CC(C)(C)C1C(OC(N)=O)CC(F)(F)CN1c1nc(Cl)nc2c(F)c(Cl)ncc12 |
| InChI | InChI=1S/C17H18Cl2F3N5O2/c1-16(2,3)11-8(29-15(23)28)4-17(21,22)6-27(11)13-7-5-24-12(18)9(20)10(7)25-14(19)26-13/h5,8,11H,4,6H2,1-3H3,(H2,23,28) |
| InChIKey | LZOSZUXZHITEIO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|