C16H18Cl2FN5O2 — CID 175526535
[(2S)-2-tert-butyl-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)pyrrolidin-3-yl] carbamate (PubChem CID 175526535) has the molecular formula C16H18Cl2FN5O2 and a molecular weight of 402.26 g/mol. Its IUPAC name is [(2S)-2-tert-butyl-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)pyrrolidin-3-yl] carbamate.
| Compound Name | [(2S)-2-tert-butyl-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)pyrrolidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175526535 |
| Molecular Formula | C16H18Cl2FN5O2 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | [(2S)-2-tert-butyl-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)pyrrolidin-3-yl] carbamate |
| SMILES | CC(C)(C)[C@H]1C(OC(N)=O)CCN1c1nc(Cl)nc2c(F)c(Cl)ncc12 |
| InChI | InChI=1S/C16H18Cl2FN5O2/c1-16(2,3)11-8(26-15(20)25)4-5-24(11)13-7-6-21-12(17)9(19)10(7)22-14(18)23-13/h6,8,11H,4-5H2,1-3H3,(H2,20,25)/t8?,11-/m1/s1 |
| InChIKey | LXPPGWJEFXSCQD-QHDYGNBISA-N |
| XLogP | 3.56 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|