C18H23ClFN5O2 — CID 154644434
tert-butyl (2R,5S)-4-(7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 154644434) has the molecular formula C18H23ClFN5O2 and a molecular weight of 395.87 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-(7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-(7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 154644434 |
| Molecular Formula | C18H23ClFN5O2 |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | tert-butyl (2R,5S)-4-(7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2ncnc3c(F)c(Cl)ncc23)[C@@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23ClFN5O2/c1-10-8-25(17(26)27-18(3,4)5)11(2)7-24(10)16-12-6-21-15(19)13(20)14(12)22-9-23-16/h6,9-11H,7-8H2,1-5H3/t10-,11+/m0/s1 |
| InChIKey | FHXRZCXJYJLSRW-WDEREUQCSA-N |
| XLogP | 3.65 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|