C16H18Cl2FN5O — CID 168908140
2,7-dichloro-4-[1-(ethoxymethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoropyrido[4,3-d]pyrimidine (PubChem CID 168908140) has the molecular formula C16H18Cl2FN5O and a molecular weight of 386.26 g/mol. Its IUPAC name is 2,7-dichloro-4-[1-(ethoxymethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoropyrido[4,3-d]pyrimidine.
| Compound Name | 2,7-dichloro-4-[1-(ethoxymethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 168908140 |
| Molecular Formula | C16H18Cl2FN5O |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2,7-dichloro-4-[1-(ethoxymethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoropyrido[4,3-d]pyrimidine |
| SMILES | CCOCC12CCC(CN(c3nc(Cl)nc4c(F)c(Cl)ncc34)C1)N2 |
| InChI | InChI=1S/C16H18Cl2FN5O/c1-2-25-8-16-4-3-9(23-16)6-24(7-16)14-10-5-20-13(17)11(19)12(10)21-15(18)22-14/h5,9,23H,2-4,6-8H2,1H3 |
| InChIKey | LAZHSKGUODCTRK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|