C15H17N3O7 — CID 108731347
methyl 1-(4-methyl-3,5-dinitrobenzoyl)piperidine-3-carboxylate (PubChem CID 108731347) has the molecular formula C15H17N3O7 and a molecular weight of 351.32 g/mol. Its IUPAC name is methyl 1-(4-methyl-3,5-dinitrobenzoyl)piperidine-3-carboxylate.
| Compound Name | methyl 1-(4-methyl-3,5-dinitrobenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 108731347 |
| Molecular Formula | C15H17N3O7 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | methyl 1-(4-methyl-3,5-dinitrobenzoyl)piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)c2cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C15H17N3O7/c1-9-12(17(21)22)6-11(7-13(9)18(23)24)14(19)16-5-3-4-10(8-16)15(20)25-2/h6-7,10H,3-5,8H2,1-2H3 |
| InChIKey | PRVDVAJVUWHAGV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|