C12H15N3O5 — CID 78919737
methyl 1-(4-nitro-1H-pyrrole-2-carbonyl)piperidine-3-carboxylate (PubChem CID 78919737) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl 1-(4-nitro-1H-pyrrole-2-carbonyl)piperidine-3-carboxylate.
| Compound Name | methyl 1-(4-nitro-1H-pyrrole-2-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919737 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | methyl 1-(4-nitro-1H-pyrrole-2-carbonyl)piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)c2cc([N+](=O)[O-])c[nH]2)C1 |
| InChI | InChI=1S/C12H15N3O5/c1-20-12(17)8-3-2-4-14(7-8)11(16)10-5-9(6-13-10)15(18)19/h5-6,8,13H,2-4,7H2,1H3 |
| InChIKey | ZZVCPDLXGJQDED-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|