C19H24N2O3 — CID 170459132
tert-butyl N-[1-(3-ethynylbenzoyl)piperidin-3-yl]carbamate (PubChem CID 170459132) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl N-[1-(3-ethynylbenzoyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-ethynylbenzoyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 170459132 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | tert-butyl N-[1-(3-ethynylbenzoyl)piperidin-3-yl]carbamate |
| SMILES | C#Cc1cccc(C(=O)N2CCCC(NC(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-5-14-8-6-9-15(12-14)17(22)21-11-7-10-16(13-21)20-18(23)24-19(2,3)4/h1,6,8-9,12,16H,7,10-11,13H2,2-4H3,(H,20,23) |
| InChIKey | SHXDQXOPDWFGTQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|