C14H23N3O3 — CID 94193162
tert-butyl N-[(3S)-1-(prop-2-ynylcarbamoyl)piperidin-3-yl]carbamate (PubChem CID 94193162) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(prop-2-ynylcarbamoyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(prop-2-ynylcarbamoyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 94193162 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | tert-butyl N-[(3S)-1-(prop-2-ynylcarbamoyl)piperidin-3-yl]carbamate |
| SMILES | C#CCNC(=O)N1CCC[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H23N3O3/c1-5-8-15-12(18)17-9-6-7-11(10-17)16-13(19)20-14(2,3)4/h1,11H,6-10H2,2-4H3,(H,15,18)(H,16,19)/t11-/m0/s1 |
| InChIKey | WLZMIDIXFQQGMD-NSHDSACASA-N |
| XLogP | 1.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|