C17H24IN3O3 — CID 165429722
tert-butyl N-[(3R)-1-[(4-iodophenyl)carbamoyl]piperidin-3-yl]carbamate (PubChem CID 165429722) has the molecular formula C17H24IN3O3 and a molecular weight of 445.30 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[(4-iodophenyl)carbamoyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[(4-iodophenyl)carbamoyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 165429722 |
| Molecular Formula | C17H24IN3O3 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | tert-butyl N-[(3R)-1-[(4-iodophenyl)carbamoyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(C(=O)Nc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C17H24IN3O3/c1-17(2,3)24-16(23)20-14-5-4-10-21(11-14)15(22)19-13-8-6-12(18)7-9-13/h6-9,14H,4-5,10-11H2,1-3H3,(H,19,22)(H,20,23)/t14-/m1/s1 |
| InChIKey | IXVZFGLGZQBNHP-CQSZACIVSA-N |
| XLogP | 3.81 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|