C16H23N3O3 — CID 110874414
tert-butyl N-[1-(phenylcarbamoyl)pyrrolidin-3-yl]carbamate (PubChem CID 110874414) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is tert-butyl N-[1-(phenylcarbamoyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(phenylcarbamoyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 110874414 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | tert-butyl N-[1-(phenylcarbamoyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C16H23N3O3/c1-16(2,3)22-15(21)18-13-9-10-19(11-13)14(20)17-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | LAMKDAVQFIFVGP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |