C33H38N6O3 — CID 86593410
tert-butyl N-[(3R)-1-[[1-methyl-5-(tritylamino)pyrazol-4-yl]carbamoyl]pyrrolidin-3-yl]carbamate (PubChem CID 86593410) has the molecular formula C33H38N6O3 and a molecular weight of 566.71 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[[1-methyl-5-(tritylamino)pyrazol-4-yl]carbamoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[[1-methyl-5-(tritylamino)pyrazol-4-yl]carbamoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86593410 |
| Molecular Formula | C33H38N6O3 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | tert-butyl N-[(3R)-1-[[1-methyl-5-(tritylamino)pyrazol-4-yl]carbamoyl]pyrrolidin-3-yl]carbamate |
| SMILES | Cn1ncc(NC(=O)N2CC[C@@H](NC(=O)OC(C)(C)C)C2)c1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H38N6O3/c1-32(2,3)42-31(41)35-27-20-21-39(23-27)30(40)36-28-22-34-38(4)29(28)37-33(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,22,27,37H,20-21,23H2,1-4H3,(H,35,41)(H,36,40)/t27-/m1/s1 |
| InChIKey | XKESJCGNAHKCEG-HHHXNRCGSA-N |
| XLogP | 5.95 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|