C31H36N6O3 — CID 90711748
2-[[1-methyl-5-(tritylamino)pyrazol-4-yl]carbamoylamino]ethyl N-tert-butylcarbamate (PubChem CID 90711748) has the molecular formula C31H36N6O3 and a molecular weight of 540.67 g/mol. Its IUPAC name is 2-[[1-methyl-5-(tritylamino)pyrazol-4-yl]carbamoylamino]ethyl N-tert-butylcarbamate.
| Compound Name | 2-[[1-methyl-5-(tritylamino)pyrazol-4-yl]carbamoylamino]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90711748 |
| Molecular Formula | C31H36N6O3 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | 2-[[1-methyl-5-(tritylamino)pyrazol-4-yl]carbamoylamino]ethyl N-tert-butylcarbamate |
| SMILES | Cn1ncc(NC(=O)NCCOC(=O)NC(C)(C)C)c1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36N6O3/c1-30(2,3)36-29(39)40-21-20-32-28(38)34-26-22-33-37(4)27(26)35-31(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22,35H,20-21H2,1-4H3,(H,36,39)(H2,32,34,38) |
| InChIKey | YKDBOAFAMSDSSM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 109.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|