C14H20ClN3O3 — CID 153406093
2-[(2-chlorophenyl)carbamoylamino]ethyl N-tert-butylcarbamate (PubChem CID 153406093) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)carbamoylamino]ethyl N-tert-butylcarbamate.
| Compound Name | 2-[(2-chlorophenyl)carbamoylamino]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 153406093 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[(2-chlorophenyl)carbamoylamino]ethyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCNC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H20ClN3O3/c1-14(2,3)18-13(20)21-9-8-16-12(19)17-11-7-5-4-6-10(11)15/h4-7H,8-9H2,1-3H3,(H,18,20)(H2,16,17,19) |
| InChIKey | DDROYFAXGQIXLN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|