C11H13ClN2O4 — CID 66173014
3-[(2-chlorophenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66173014) has the molecular formula C11H13ClN2O4 and a molecular weight of 272.69 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(2-chlorophenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66173014 |
| Molecular Formula | C11H13ClN2O4 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-[(2-chlorophenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNC(=O)Nc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H13ClN2O4/c1-11(18,9(15)16)6-13-10(17)14-8-5-3-2-4-7(8)12/h2-5,18H,6H2,1H3,(H,15,16)(H2,13,14,17) |
| InChIKey | LAEHCWNYALXNJQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |