C13H18ClN3O4 — CID 122076471
3-[[3-chloro-2-(dimethylamino)phenyl]carbamoylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122076471) has the molecular formula C13H18ClN3O4 and a molecular weight of 315.76 g/mol. Its IUPAC name is 3-[[3-chloro-2-(dimethylamino)phenyl]carbamoylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[[3-chloro-2-(dimethylamino)phenyl]carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122076471 |
| Molecular Formula | C13H18ClN3O4 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 3-[[3-chloro-2-(dimethylamino)phenyl]carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CN(C)c1c(Cl)cccc1NC(=O)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C13H18ClN3O4/c1-13(21,11(18)19)7-15-12(20)16-9-6-4-5-8(14)10(9)17(2)3/h4-6,21H,7H2,1-3H3,(H,18,19)(H2,15,16,20) |
| InChIKey | WGPAYGULQAMGJW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |