C15H24ClN3O2 — CID 111103609
1-[3-chloro-2-(dimethylamino)phenyl]-3-(2-ethyl-2-hydroxybutyl)urea (PubChem CID 111103609) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is 1-[3-chloro-2-(dimethylamino)phenyl]-3-(2-ethyl-2-hydroxybutyl)urea.
| Compound Name | 1-[3-chloro-2-(dimethylamino)phenyl]-3-(2-ethyl-2-hydroxybutyl)urea |
|---|---|
| PubChem CID | 111103609 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-[3-chloro-2-(dimethylamino)phenyl]-3-(2-ethyl-2-hydroxybutyl)urea |
| SMILES | CCC(O)(CC)CNC(=O)Nc1cccc(Cl)c1N(C)C |
| InChI | InChI=1S/C15H24ClN3O2/c1-5-15(21,6-2)10-17-14(20)18-12-9-7-8-11(16)13(12)19(3)4/h7-9,21H,5-6,10H2,1-4H3,(H2,17,18,20) |
| InChIKey | LQICTZQHSNFSAQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |