C34H40N6O5 — CID 90741513
[5-carbamoyloxy-6,6-dimethyl-1-[[1-methyl-5-(tritylamino)pyrazol-4-yl]amino]-1-oxoheptan-2-yl] carbamate (PubChem CID 90741513) has the molecular formula C34H40N6O5 and a molecular weight of 612.73 g/mol. Its IUPAC name is [5-carbamoyloxy-6,6-dimethyl-1-[[1-methyl-5-(tritylamino)pyrazol-4-yl]amino]-1-oxoheptan-2-yl] carbamate.
| Compound Name | [5-carbamoyloxy-6,6-dimethyl-1-[[1-methyl-5-(tritylamino)pyrazol-4-yl]amino]-1-oxoheptan-2-yl] carbamate |
|---|---|
| PubChem CID | 90741513 |
| Molecular Formula | C34H40N6O5 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | [5-carbamoyloxy-6,6-dimethyl-1-[[1-methyl-5-(tritylamino)pyrazol-4-yl]amino]-1-oxoheptan-2-yl] carbamate |
| SMILES | Cn1ncc(NC(=O)C(CCC(OC(N)=O)C(C)(C)C)OC(N)=O)c1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H40N6O5/c1-33(2,3)28(45-32(36)43)21-20-27(44-31(35)42)30(41)38-26-22-37-40(4)29(26)39-34(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22,27-28,39H,20-21H2,1-4H3,(H2,35,42)(H2,36,43)(H,38,41) |
| InChIKey | XSNSXBLJPWZDKK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 163.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|