C20H27N4O3S+ — CID 9204955
3-[methyl-(4-methylphenyl)sulfamoyl]-N-(4-methylpiperazin-4-ium-1-yl)benzamide (PubChem CID 9204955) has the molecular formula C20H27N4O3S+ and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-[methyl-(4-methylphenyl)sulfamoyl]-N-(4-methylpiperazin-4-ium-1-yl)benzamide.
| Compound Name | 3-[methyl-(4-methylphenyl)sulfamoyl]-N-(4-methylpiperazin-4-ium-1-yl)benzamide |
|---|---|
| PubChem CID | 9204955 |
| Molecular Formula | C20H27N4O3S+ |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 3-[methyl-(4-methylphenyl)sulfamoyl]-N-(4-methylpiperazin-4-ium-1-yl)benzamide |
| SMILES | Cc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)NN3CC[NH+](C)CC3)c2)cc1 |
| InChI | InChI=1S/C20H26N4O3S/c1-16-7-9-18(10-8-16)23(3)28(26,27)19-6-4-5-17(15-19)20(25)21-24-13-11-22(2)12-14-24/h4-10,15H,11-14H2,1-3H3,(H,21,25)/p+1 |
| InChIKey | KFHFJVDMFOAANW-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |