C19H25N4O3S+ — CID 7414536
3-(benzylsulfamoyl)-N-(4-methylpiperazin-4-ium-1-yl)benzamide (PubChem CID 7414536) has the molecular formula C19H25N4O3S+ and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-N-(4-methylpiperazin-4-ium-1-yl)benzamide.
| Compound Name | 3-(benzylsulfamoyl)-N-(4-methylpiperazin-4-ium-1-yl)benzamide |
|---|---|
| PubChem CID | 7414536 |
| Molecular Formula | C19H25N4O3S+ |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 3-(benzylsulfamoyl)-N-(4-methylpiperazin-4-ium-1-yl)benzamide |
| SMILES | C[NH+]1CCN(NC(=O)c2cccc(S(=O)(=O)NCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C19H24N4O3S/c1-22-10-12-23(13-11-22)21-19(24)17-8-5-9-18(14-17)27(25,26)20-15-16-6-3-2-4-7-16/h2-9,14,20H,10-13,15H2,1H3,(H,21,24)/p+1 |
| InChIKey | SFHGFLNDVXXNKE-UHFFFAOYSA-O |
| XLogP | -0.36 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |