C18H12F6O3 — CID 19542694
(E)-1-[3-(difluoromethoxy)phenyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one (PubChem CID 19542694) has the molecular formula C18H12F6O3 and a molecular weight of 390.28 g/mol. Its IUPAC name is (E)-1-[3-(difluoromethoxy)phenyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542694 |
| Molecular Formula | C18H12F6O3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(OC(F)(F)C(F)F)c1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C18H12F6O3/c19-16(20)18(23,24)27-14-6-1-3-11(9-14)7-8-15(25)12-4-2-5-13(10-12)26-17(21)22/h1-10,16-17H/b8-7+ |
| InChIKey | FBWOTWURYSRXFX-BQYQJAHWSA-N |
| XLogP | 5.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|