C23H29N3O5S — CID 17148501
2-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N-(3-methoxypropyl)benzamide (PubChem CID 17148501) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 2-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 17148501 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N-(3-methoxypropyl)benzamide |
| SMILES | CCOCCOc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)NCCCOC)c1 |
| InChI | InChI=1S/C23H29N3O5S/c1-3-30-14-15-31-18-9-6-8-17(16-18)21(27)26-23(32)25-20-11-5-4-10-19(20)22(28)24-12-7-13-29-2/h4-6,8-11,16H,3,7,12-15H2,1-2H3,(H,24,28)(H2,25,26,27,32) |
| InChIKey | NLJPEBZODFLHQE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|