C21H24N4O3S — CID 19581728
1-[[3-[(4-cyanophenoxy)methyl]benzoyl]amino]-3-(3-ethoxypropyl)thiourea (PubChem CID 19581728) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 1-[[3-[(4-cyanophenoxy)methyl]benzoyl]amino]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-[[3-[(4-cyanophenoxy)methyl]benzoyl]amino]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 19581728 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-[[3-[(4-cyanophenoxy)methyl]benzoyl]amino]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)NNC(=O)c1cccc(COc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C21H24N4O3S/c1-2-27-12-4-11-23-21(29)25-24-20(26)18-6-3-5-17(13-18)15-28-19-9-7-16(14-22)8-10-19/h3,5-10,13H,2,4,11-12,15H2,1H3,(H,24,26)(H2,23,25,29) |
| InChIKey | SYXKROYJJHOKFC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|