C13H20N4O3S — CID 8617417
1-[[2-(4-methoxyanilino)acetyl]amino]-3-(2-methoxyethyl)thiourea (PubChem CID 8617417) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-[[2-(4-methoxyanilino)acetyl]amino]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[[2-(4-methoxyanilino)acetyl]amino]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 8617417 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[[2-(4-methoxyanilino)acetyl]amino]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NNC(=O)CNc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H20N4O3S/c1-19-8-7-14-13(21)17-16-12(18)9-15-10-3-5-11(20-2)6-4-10/h3-6,15H,7-9H2,1-2H3,(H,16,18)(H2,14,17,21) |
| InChIKey | KVUDOSOVXQJGKY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|