C20H24N2O4S2 — CID 47023932
1-(2,5-dimethoxyphenyl)-5-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]pyrrolidine-3-carboxamide (PubChem CID 47023932) has the molecular formula C20H24N2O4S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 47023932 |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(N2CC(C(=O)NCCSCc3ccsc3)CC2=O)c1 |
| InChI | InChI=1S/C20H24N2O4S2/c1-25-16-3-4-18(26-2)17(10-16)22-11-15(9-19(22)23)20(24)21-6-8-28-13-14-5-7-27-12-14/h3-5,7,10,12,15H,6,8-9,11,13H2,1-2H3,(H,21,24) |
| InChIKey | BAKPRYACUGKOBQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|