C12H15NS3 — CID 115574180
N-(thiophen-2-ylmethyl)-2-(thiophen-3-ylmethylsulfanyl)ethanamine (PubChem CID 115574180) has the molecular formula C12H15NS3 and a molecular weight of 269.46 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)-2-(thiophen-3-ylmethylsulfanyl)ethanamine.
| Compound Name | N-(thiophen-2-ylmethyl)-2-(thiophen-3-ylmethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 115574180 |
| Molecular Formula | C12H15NS3 |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N-(thiophen-2-ylmethyl)-2-(thiophen-3-ylmethylsulfanyl)ethanamine |
| SMILES | c1csc(CNCCSCc2ccsc2)c1 |
| InChI | InChI=1S/C12H15NS3/c1-2-12(16-5-1)8-13-4-7-15-10-11-3-6-14-9-11/h1-3,5-6,9,13H,4,7-8,10H2 |
| InChIKey | FPHZJXJRTGYRPN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|