C13H13Cl2NS2 — CID 112736355
2-(3,5-dichlorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)ethanamine (PubChem CID 112736355) has the molecular formula C13H13Cl2NS2 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)ethanamine.
| Compound Name | 2-(3,5-dichlorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 112736355 |
| Molecular Formula | C13H13Cl2NS2 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 2-(3,5-dichlorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)ethanamine |
| SMILES | Clc1cc(Cl)cc(SCCNCc2cccs2)c1 |
| InChI | InChI=1S/C13H13Cl2NS2/c14-10-6-11(15)8-13(7-10)18-5-3-16-9-12-2-1-4-17-12/h1-2,4,6-8,16H,3,5,9H2 |
| InChIKey | WIJDMJOHFFEIRG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|