C16H19NS2 — CID 55092488
2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-(thiophen-2-ylmethyl)ethanamine (PubChem CID 55092488) has the molecular formula C16H19NS2 and a molecular weight of 289.47 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-(thiophen-2-ylmethyl)ethanamine.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-(thiophen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 55092488 |
| Molecular Formula | C16H19NS2 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-(thiophen-2-ylmethyl)ethanamine |
| SMILES | c1csc(CNCCSc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C16H19NS2/c1-3-13-6-7-15(11-14(13)4-1)19-10-8-17-12-16-5-2-9-18-16/h2,5-7,9,11,17H,1,3-4,8,10,12H2 |
| InChIKey | GYPGPBQDOPSUPP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|