C12H19NOS2 — CID 115887244
N-(oxolan-3-ylmethyl)-2-(thiophen-3-ylmethylsulfanyl)ethanamine (PubChem CID 115887244) has the molecular formula C12H19NOS2 and a molecular weight of 257.42 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)-2-(thiophen-3-ylmethylsulfanyl)ethanamine.
| Compound Name | N-(oxolan-3-ylmethyl)-2-(thiophen-3-ylmethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 115887244 |
| Molecular Formula | C12H19NOS2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-(oxolan-3-ylmethyl)-2-(thiophen-3-ylmethylsulfanyl)ethanamine |
| SMILES | c1cc(CSCCNCC2CCOC2)cs1 |
| InChI | InChI=1S/C12H19NOS2/c1-4-14-8-11(1)7-13-3-6-16-10-12-2-5-15-9-12/h2,5,9,11,13H,1,3-4,6-8,10H2 |
| InChIKey | PXOAVYRXUZOXNV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|