C12H19NS2 — CID 115676262
1-cyclopropyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]ethanamine (PubChem CID 115676262) has the molecular formula C12H19NS2 and a molecular weight of 241.42 g/mol. Its IUPAC name is 1-cyclopropyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]ethanamine.
| Compound Name | 1-cyclopropyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 115676262 |
| Molecular Formula | C12H19NS2 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 1-cyclopropyl-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]ethanamine |
| SMILES | CC(NCCSCc1ccsc1)C1CC1 |
| InChI | InChI=1S/C12H19NS2/c1-10(12-2-3-12)13-5-7-15-9-11-4-6-14-8-11/h4,6,8,10,12-13H,2-3,5,7,9H2,1H3 |
| InChIKey | VFXIAIQJVGKQKI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|