C15H20N2O3S4 — CID 24532861
5-[2-(methanesulfonamido)ethyl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide (PubChem CID 24532861) has the molecular formula C15H20N2O3S4 and a molecular weight of 404.60 g/mol. Its IUPAC name is 5-[2-(methanesulfonamido)ethyl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-[2-(methanesulfonamido)ethyl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24532861 |
| Molecular Formula | C15H20N2O3S4 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 5-[2-(methanesulfonamido)ethyl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiophene-2-carboxamide |
| SMILES | CS(=O)(=O)NCCc1ccc(C(=O)NCCSCc2ccsc2)s1 |
| InChI | InChI=1S/C15H20N2O3S4/c1-24(19,20)17-6-4-13-2-3-14(23-13)15(18)16-7-9-22-11-12-5-8-21-10-12/h2-3,5,8,10,17H,4,6-7,9,11H2,1H3,(H,16,18) |
| InChIKey | YHHCFQQLSQFBCL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|