C15H16FN3O4S2 — CID 46523672
N-[2-[5-[[(4-fluorobenzoyl)amino]carbamoyl]thiophen-2-yl]ethyl]methanesulfonamide (PubChem CID 46523672) has the molecular formula C15H16FN3O4S2 and a molecular weight of 385.44 g/mol. Its IUPAC name is N-[2-[5-[[(4-fluorobenzoyl)amino]carbamoyl]thiophen-2-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[5-[[(4-fluorobenzoyl)amino]carbamoyl]thiophen-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 46523672 |
| Molecular Formula | C15H16FN3O4S2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-[2-[5-[[(4-fluorobenzoyl)amino]carbamoyl]thiophen-2-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCc1ccc(C(=O)NNC(=O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C15H16FN3O4S2/c1-25(22,23)17-9-8-12-6-7-13(24-12)15(21)19-18-14(20)10-2-4-11(16)5-3-10/h2-7,17H,8-9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | BMLMCROYWDXWMA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|